About 2-ethyl-N,4,5-trimethylpyrazole-3-carboxamide
2-ethyl-N,4,5-trimethylpyrazole-3-carboxamide (PubChem CID 154451968) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is 2-ethyl-N,4,5-trimethylpyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 2-ethyl-N,4,5-trimethylpyrazole-3-carboxamide |
| PubChem CID | 154451968 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 2-ethyl-N,4,5-trimethylpyrazole-3-carboxamide |
| SMILES | CCn1nc(C)c(C)c1C(=O)NC |
| InChI | InChI=1S/C9H15N3O/c1-5-12-8(9(13)10-4)6(2)7(3)11-12/h5H2,1-4H3,(H,10,13) |
| InChIKey | QNYHVGPFDNQPSA-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-N,4,5-trimethylpyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N,4,5-trimethylpyrazole-3-carboxamide?
The IUPAC name of 2-ethyl-N,4,5-trimethylpyrazole-3-carboxamide (CID 154451968) is 2-ethyl-N,4,5-trimethylpyrazole-3-carboxamide.
What is the SMILES notation for 2-ethyl-N,4,5-trimethylpyrazole-3-carboxamide?
The canonical SMILES for 2-ethyl-N,4,5-trimethylpyrazole-3-carboxamide is CCn1nc(C)c(C)c1C(=O)NC.
What is the InChIKey of 2-ethyl-N,4,5-trimethylpyrazole-3-carboxamide?
The InChIKey is QNYHVGPFDNQPSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O/c1-5-12-8(9(13)10-4)6(2)7(3)11-12/h5H2,1-4H3,(H,10,13).
What are the key properties of 2-ethyl-N,4,5-trimethylpyrazole-3-carboxamide?
2-ethyl-N,4,5-trimethylpyrazole-3-carboxamide has a molecular weight of 181.24 g/mol, XLogP of 0.88, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N,4,5-trimethylpyrazole-3-carboxamide is sourced from PubChem (CID 154451968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).