C23H15Cl2FN4O — CID 154454284
2,5-dichloro-N-[1-(4-fluorophenyl)-4,5-dihydrobenzo[g]indazol-8-yl]pyridine-4-carboxamide (PubChem CID 154454284) has the molecular formula C23H15Cl2FN4O and a molecular weight of 453.30 g/mol. Its IUPAC name is 2,5-dichloro-N-[1-(4-fluorophenyl)-4,5-dihydrobenzo[g]indazol-8-yl]pyridine-4-carboxamide.
| Compound Name | 2,5-dichloro-N-[1-(4-fluorophenyl)-4,5-dihydrobenzo[g]indazol-8-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 154454284 |
| Molecular Formula | C23H15Cl2FN4O |
| Molecular Weight | 453.30 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 2,5-dichloro-N-[1-(4-fluorophenyl)-4,5-dihydrobenzo[g]indazol-8-yl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)-c1c(cnn1-c1ccc(F)cc1)CC2)c1cc(Cl)ncc1Cl |
| InChI | InChI=1S/C23H15Cl2FN4O/c24-20-12-27-21(25)10-19(20)23(31)29-16-6-3-13-1-2-14-11-28-30(22(14)18(13)9-16)17-7-4-15(26)5-8-17/h3-12H,1-2H2,(H,29,31) |
| InChIKey | UYPAQRVIXRLSQA-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.30 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|