C10H19N5 — CID 154454818
2-methyl-6-piperidin-1-yl-1H-pyrimidine-2,4-diamine (PubChem CID 154454818) has the molecular formula C10H19N5 and a molecular weight of 209.30 g/mol. Its IUPAC name is 2-methyl-6-piperidin-1-yl-1H-pyrimidine-2,4-diamine.
| Compound Name | 2-methyl-6-piperidin-1-yl-1H-pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 154454818 |
| Molecular Formula | C10H19N5 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 2-methyl-6-piperidin-1-yl-1H-pyrimidine-2,4-diamine |
| SMILES | CC1(N)N=C(N)C=C(N2CCCCC2)N1 |
| InChI | InChI=1S/C10H19N5/c1-10(12)13-8(11)7-9(14-10)15-5-3-2-4-6-15/h7,14H,2-6,12H2,1H3,(H2,11,13) |
| InChIKey | LWQZMVOWURBAQZ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |