C16H24O2S — CID 15445548
1-(2-hydroxy-2-methyl-1-phenylsulfanylpropyl)cyclohexan-1-ol (PubChem CID 15445548) has the molecular formula C16H24O2S and a molecular weight of 280.43 g/mol. Its IUPAC name is 1-(2-hydroxy-2-methyl-1-phenylsulfanylpropyl)cyclohexan-1-ol.
| Compound Name | 1-(2-hydroxy-2-methyl-1-phenylsulfanylpropyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 15445548 |
| Molecular Formula | C16H24O2S |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 1-(2-hydroxy-2-methyl-1-phenylsulfanylpropyl)cyclohexan-1-ol |
| SMILES | CC(C)(O)C(Sc1ccccc1)C1(O)CCCCC1 |
| InChI | InChI=1S/C16H24O2S/c1-15(2,17)14(16(18)11-7-4-8-12-16)19-13-9-5-3-6-10-13/h3,5-6,9-10,14,17-18H,4,7-8,11-12H2,1-2H3 |
| InChIKey | UWXRVZLPPMKCPY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |