C26H35N3O7S — CID 154455920
methyl 2-[N-[(2-methylpropan-2-yl)oxycarbonylsulfamoyl]-4-[(5-phenylpentanoylamino)methyl]anilino]acetate (PubChem CID 154455920) has the molecular formula C26H35N3O7S and a molecular weight of 533.65 g/mol. Its IUPAC name is methyl 2-[N-[(2-methylpropan-2-yl)oxycarbonylsulfamoyl]-4-[(5-phenylpentanoylamino)methyl]anilino]acetate.
| Compound Name | methyl 2-[N-[(2-methylpropan-2-yl)oxycarbonylsulfamoyl]-4-[(5-phenylpentanoylamino)methyl]anilino]acetate |
|---|---|
| PubChem CID | 154455920 |
| Molecular Formula | C26H35N3O7S |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | methyl 2-[N-[(2-methylpropan-2-yl)oxycarbonylsulfamoyl]-4-[(5-phenylpentanoylamino)methyl]anilino]acetate |
| SMILES | COC(=O)CN(c1ccc(CNC(=O)CCCCc2ccccc2)cc1)S(=O)(=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H35N3O7S/c1-26(2,3)36-25(32)28-37(33,34)29(19-24(31)35-4)22-16-14-21(15-17-22)18-27-23(30)13-9-8-12-20-10-6-5-7-11-20/h5-7,10-11,14-17H,8-9,12-13,18-19H2,1-4H3,(H,27,30)(H,28,32) |
| InChIKey | ULHJDFTWCXGCOV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|