C19H24BNO3 — CID 127027217
[4-[(6-phenylhexanoylamino)methyl]phenyl]boronic acid (PubChem CID 127027217) has the molecular formula C19H24BNO3 and a molecular weight of 325.22 g/mol. Its IUPAC name is [4-[(6-phenylhexanoylamino)methyl]phenyl]boronic acid.
| Compound Name | [4-[(6-phenylhexanoylamino)methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 127027217 |
| Molecular Formula | C19H24BNO3 |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | [4-[(6-phenylhexanoylamino)methyl]phenyl]boronic acid |
| SMILES | O=C(CCCCCc1ccccc1)NCc1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C19H24BNO3/c22-19(10-6-2-5-9-16-7-3-1-4-8-16)21-15-17-11-13-18(14-12-17)20(23)24/h1,3-4,7-8,11-14,23-24H,2,5-6,9-10,15H2,(H,21,22) |
| InChIKey | LKZVPDMBCGGOJE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|