C24H24INO — CID 174907629
5-(3-iodophenyl)-N-[(4-phenylphenyl)methyl]pentanamide (PubChem CID 174907629) has the molecular formula C24H24INO and a molecular weight of 469.37 g/mol. Its IUPAC name is 5-(3-iodophenyl)-N-[(4-phenylphenyl)methyl]pentanamide.
| Compound Name | 5-(3-iodophenyl)-N-[(4-phenylphenyl)methyl]pentanamide |
|---|---|
| PubChem CID | 174907629 |
| Molecular Formula | C24H24INO |
| Molecular Weight | 469.37 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | 5-(3-iodophenyl)-N-[(4-phenylphenyl)methyl]pentanamide |
| SMILES | O=C(CCCCc1cccc(I)c1)NCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H24INO/c25-23-11-6-8-19(17-23)7-4-5-12-24(27)26-18-20-13-15-22(16-14-20)21-9-2-1-3-10-21/h1-3,6,8-11,13-17H,4-5,7,12,18H2,(H,26,27) |
| InChIKey | HEIQOWTVVJLHQK-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.37 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|