C18H17O5+ — CID 15445968
4-(4-ethoxy-6-methoxychromenylium-2-yl)benzene-1,2-diol (PubChem CID 15445968) has the molecular formula C18H17O5+ and a molecular weight of 313.33 g/mol. Its IUPAC name is 4-(4-ethoxy-6-methoxychromenylium-2-yl)benzene-1,2-diol.
| Compound Name | 4-(4-ethoxy-6-methoxychromenylium-2-yl)benzene-1,2-diol |
|---|---|
| PubChem CID | 15445968 |
| Molecular Formula | C18H17O5+ |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 4-(4-ethoxy-6-methoxychromenylium-2-yl)benzene-1,2-diol |
| SMILES | CCOc1cc(-c2ccc(O)c(O)c2)[o+]c2ccc(OC)cc12 |
| InChI | InChI=1S/C18H16O5/c1-3-22-18-10-17(11-4-6-14(19)15(20)8-11)23-16-7-5-12(21-2)9-13(16)18/h4-10H,3H2,1-2H3,(H-,19,20)/p+1 |
| InChIKey | JMPGLXAHBSVJBZ-UHFFFAOYSA-O |
| XLogP | 4.20 |
| TPSA | 70.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|