C16H13ClO4 — CID 10566458
4-(7-methoxychromenylium-2-yl)benzene-1,2-diol chloride (PubChem CID 10566458) has the molecular formula C16H13ClO4 and a molecular weight of 304.73 g/mol. Its IUPAC name is 4-(7-methoxychromenylium-2-yl)benzene-1,2-diol chloride.
| Compound Name | 4-(7-methoxychromenylium-2-yl)benzene-1,2-diol chloride |
|---|---|
| PubChem CID | 10566458 |
| Molecular Formula | C16H13ClO4 |
| Molecular Weight | 304.73 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 4-(7-methoxychromenylium-2-yl)benzene-1,2-diol chloride |
| SMILES | COc1ccc2ccc(-c3ccc(O)c(O)c3)[o+]c2c1.[Cl-] |
| InChI | InChI=1S/C16H12O4.ClH/c1-19-12-5-2-10-4-7-15(20-16(10)9-12)11-3-6-13(17)14(18)8-11;/h2-9H,1H3,(H-,17,18);1H |
| InChIKey | YKKWJTNGQRCUHL-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 60.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.73 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|