About 4-(7-methoxychromenylium-2-yl)benzene-1,2-diol chloride
4-(7-methoxychromenylium-2-yl)benzene-1,2-diol chloride (PubChem CID 10566458) has the molecular formula C16H13ClO4
and a molecular weight of 304.73 g/mol. Its IUPAC name is 4-(7-methoxychromenylium-2-yl)benzene-1,2-diol chloride.
Molecular Properties
| Compound Name | 4-(7-methoxychromenylium-2-yl)benzene-1,2-diol chloride |
| PubChem CID | 10566458 |
| Molecular Formula | C16H13ClO4 |
| Molecular Weight | 304.73 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 4-(7-methoxychromenylium-2-yl)benzene-1,2-diol chloride |
| SMILES | COc1ccc2ccc(-c3ccc(O)c(O)c3)[o+]c2c1.[Cl-] |
| InChI | InChI=1S/C16H12O4.ClH/c1-19-12-5-2-10-4-7-15(20-16(10)9-12)11-3-6-13(17)14(18)8-11;/h2-9H,1H3,(H-,17,18);1H |
| InChIKey | YKKWJTNGQRCUHL-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 60.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.73 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 4-(7-methoxychromenylium-2-yl)benzene-1,2-diol chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(7-methoxychromenylium-2-yl)benzene-1,2-diol chloride?
The IUPAC name of 4-(7-methoxychromenylium-2-yl)benzene-1,2-diol chloride (CID 10566458) is 4-(7-methoxychromenylium-2-yl)benzene-1,2-diol chloride.
What is the SMILES notation for 4-(7-methoxychromenylium-2-yl)benzene-1,2-diol chloride?
The canonical SMILES for 4-(7-methoxychromenylium-2-yl)benzene-1,2-diol chloride is COc1ccc2ccc(-c3ccc(O)c(O)c3)[o+]c2c1.[Cl-].
What is the InChIKey of 4-(7-methoxychromenylium-2-yl)benzene-1,2-diol chloride?
The InChIKey is YKKWJTNGQRCUHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12O4.ClH/c1-19-12-5-2-10-4-7-15(20-16(10)9-12)11-3-6-13(17)14(18)8-11;/h2-9H,1H3,(H-,17,18);1H.
What are the key properties of 4-(7-methoxychromenylium-2-yl)benzene-1,2-diol chloride?
4-(7-methoxychromenylium-2-yl)benzene-1,2-diol chloride has a molecular weight of 304.73 g/mol, XLogP of 0.80, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(7-methoxychromenylium-2-yl)benzene-1,2-diol chloride is sourced from PubChem (CID 10566458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).