C22H24BrNO3 — CID 154468057
2-[2-[[3-bromo-5-[2-(1-methylpyrrolidin-2-yl)ethenyl]phenyl]methoxy]phenyl]acetic acid (PubChem CID 154468057) has the molecular formula C22H24BrNO3 and a molecular weight of 430.34 g/mol. Its IUPAC name is 2-[2-[[3-bromo-5-[2-(1-methylpyrrolidin-2-yl)ethenyl]phenyl]methoxy]phenyl]acetic acid.
| Compound Name | 2-[2-[[3-bromo-5-[2-(1-methylpyrrolidin-2-yl)ethenyl]phenyl]methoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 154468057 |
| Molecular Formula | C22H24BrNO3 |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 2-[2-[[3-bromo-5-[2-(1-methylpyrrolidin-2-yl)ethenyl]phenyl]methoxy]phenyl]acetic acid |
| SMILES | CN1CCCC1C=Cc1cc(Br)cc(COc2ccccc2CC(=O)O)c1 |
| InChI | InChI=1S/C22H24BrNO3/c1-24-10-4-6-20(24)9-8-16-11-17(13-19(23)12-16)15-27-21-7-3-2-5-18(21)14-22(25)26/h2-3,5,7-9,11-13,20H,4,6,10,14-15H2,1H3,(H,25,26) |
| InChIKey | DIWYMIJFGLDJJZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |