C8H16N2O2 — CID 154468821
ethyl (Z)-2,5-diaminohex-3-enoate (PubChem CID 154468821) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is ethyl (Z)-2,5-diaminohex-3-enoate.
| Compound Name | ethyl (Z)-2,5-diaminohex-3-enoate |
|---|---|
| PubChem CID | 154468821 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | ethyl (Z)-2,5-diaminohex-3-enoate |
| SMILES | CCOC(=O)C(N)/C=C\C(C)N |
| InChI | InChI=1S/C8H16N2O2/c1-3-12-8(11)7(10)5-4-6(2)9/h4-7H,3,9-10H2,1-2H3/b5-4- |
| InChIKey | GBPPPXCWXURDIU-PLNGDYQASA-N |
| XLogP | -0.22 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|