C14H20N2O2 — CID 154469852
1-[(Z)-4-[(Z)-2-(methylideneamino)ethenyl]hex-4-enyl]piperidine-2,6-dione (PubChem CID 154469852) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 1-[(Z)-4-[(Z)-2-(methylideneamino)ethenyl]hex-4-enyl]piperidine-2,6-dione.
| Compound Name | 1-[(Z)-4-[(Z)-2-(methylideneamino)ethenyl]hex-4-enyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 154469852 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 1-[(Z)-4-[(Z)-2-(methylideneamino)ethenyl]hex-4-enyl]piperidine-2,6-dione |
| SMILES | C=N/C=C\C(=C/C)CCCN1C(=O)CCCC1=O |
| InChI | InChI=1S/C14H20N2O2/c1-3-12(9-10-15-2)6-5-11-16-13(17)7-4-8-14(16)18/h3,9-10H,2,4-8,11H2,1H3/b10-9-,12-3- |
| InChIKey | LQFXKSAZJPSGFI-ZSWLAKRQSA-N |
| XLogP | 2.47 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|