C9H11N4+ — CID 154473891
N'-(3-methyl-1H-benzimidazol-3-ium-2-yl)methanimidamide (PubChem CID 154473891) has the molecular formula C9H11N4+ and a molecular weight of 175.21 g/mol. Its IUPAC name is N'-(3-methyl-1H-benzimidazol-3-ium-2-yl)methanimidamide.
| Compound Name | N'-(3-methyl-1H-benzimidazol-3-ium-2-yl)methanimidamide |
|---|---|
| PubChem CID | 154473891 |
| Molecular Formula | C9H11N4+ |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | N'-(3-methyl-1H-benzimidazol-3-ium-2-yl)methanimidamide |
| SMILES | C[n+]1c(N=CN)[nH]c2ccccc21 |
| InChI | InChI=1S/C9H10N4/c1-13-8-5-3-2-4-7(8)12-9(13)11-6-10/h2-6H,1H3,(H2,10,11,12)/p+1 |
| InChIKey | JCDZUEGDZNTVAO-UHFFFAOYSA-O |
| XLogP | 0.61 |
| TPSA | 58.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|