C20H19N4O+ — CID 59814073
3-methyl-2-[5-(3-methyl-1,2-dihydrobenzimidazol-2-yl)furan-2-yl]-1H-benzimidazol-3-ium (PubChem CID 59814073) has the molecular formula C20H19N4O+ and a molecular weight of 331.40 g/mol. Its IUPAC name is 3-methyl-2-[5-(3-methyl-1,2-dihydrobenzimidazol-2-yl)furan-2-yl]-1H-benzimidazol-3-ium.
| Compound Name | 3-methyl-2-[5-(3-methyl-1,2-dihydrobenzimidazol-2-yl)furan-2-yl]-1H-benzimidazol-3-ium |
|---|---|
| PubChem CID | 59814073 |
| Molecular Formula | C20H19N4O+ |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 3-methyl-2-[5-(3-methyl-1,2-dihydrobenzimidazol-2-yl)furan-2-yl]-1H-benzimidazol-3-ium |
| SMILES | CN1c2ccccc2NC1c1ccc(-c2[nH]c3ccccc3[n+]2C)o1 |
| InChI | InChI=1S/C20H18N4O/c1-23-15-9-5-3-7-13(15)21-19(23)17-11-12-18(25-17)20-22-14-8-4-6-10-16(14)24(20)2/h3-12,19,21H,1-2H3/p+1 |
| InChIKey | QQUGEIAPISSXGQ-UHFFFAOYSA-O |
| XLogP | 3.81 |
| TPSA | 48.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|