C15H19N3O — CID 23266598
(NZ)-N-[(1R,2R,11S,12S)-3-methyl-3,10-diazatetracyclo[10.3.1.02,11.04,9]hexadeca-4,6,8-trien-16-ylidene]hydroxylamine (PubChem CID 23266598) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is (NZ)-N-[(1R,2R,11S,12S)-3-methyl-3,10-diazatetracyclo[10.3.1.02,11.04,9]hexadeca-4,6,8-trien-16-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(1R,2R,11S,12S)-3-methyl-3,10-diazatetracyclo[10.3.1.02,11.04,9]hexadeca-4,6,8-trien-16-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 23266598 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | (NZ)-N-[(1R,2R,11S,12S)-3-methyl-3,10-diazatetracyclo[10.3.1.02,11.04,9]hexadeca-4,6,8-trien-16-ylidene]hydroxylamine |
| SMILES | CN1c2ccccc2N[C@@H]2[C@H]1[C@H]1CCC[C@@H]2/C1=N/O |
| InChI | InChI=1S/C15H19N3O/c1-18-12-8-3-2-7-11(12)16-14-9-5-4-6-10(15(14)18)13(9)17-19/h2-3,7-10,14-16,19H,4-6H2,1H3/b17-13-/t9-,10+,14+,15-/m1/s1 |
| InChIKey | WRBPOHMKEPAUOM-HHTXENRZSA-N |
| XLogP | 2.55 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|