C22H23NO4 — CID 15447488
N-butyl-2-(2-hydroxyphenyl)-3-oxo-1,2,2a,8b-tetrahydrocyclobuta[c]chromene-1-carboxamide (PubChem CID 15447488) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is N-butyl-2-(2-hydroxyphenyl)-3-oxo-1,2,2a,8b-tetrahydrocyclobuta[c]chromene-1-carboxamide.
| Compound Name | N-butyl-2-(2-hydroxyphenyl)-3-oxo-1,2,2a,8b-tetrahydrocyclobuta[c]chromene-1-carboxamide |
|---|---|
| PubChem CID | 15447488 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | N-butyl-2-(2-hydroxyphenyl)-3-oxo-1,2,2a,8b-tetrahydrocyclobuta[c]chromene-1-carboxamide |
| SMILES | CCCCNC(=O)C1C(c2ccccc2O)C2C(=O)Oc3ccccc3C12 |
| InChI | InChI=1S/C22H23NO4/c1-2-3-12-23-21(25)19-17(13-8-4-6-10-15(13)24)20-18(19)14-9-5-7-11-16(14)27-22(20)26/h4-11,17-20,24H,2-3,12H2,1H3,(H,23,25) |
| InChIKey | LQSSZQQCFTUNFS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|