C15H16N2O4S — CID 20831982
1-butyl-3-[(Z)-(2,4-dioxochromen-3-ylidene)methyl]sulfanylurea (PubChem CID 20831982) has the molecular formula C15H16N2O4S and a molecular weight of 320.37 g/mol. Its IUPAC name is 1-butyl-3-[(Z)-(2,4-dioxochromen-3-ylidene)methyl]sulfanylurea.
| Compound Name | 1-butyl-3-[(Z)-(2,4-dioxochromen-3-ylidene)methyl]sulfanylurea |
|---|---|
| PubChem CID | 20831982 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 1-butyl-3-[(Z)-(2,4-dioxochromen-3-ylidene)methyl]sulfanylurea |
| SMILES | CCCCNC(=O)NS/C=C1\C(=O)Oc2ccccc2C1=O |
| InChI | InChI=1S/C15H16N2O4S/c1-2-3-8-16-15(20)17-22-9-11-13(18)10-6-4-5-7-12(10)21-14(11)19/h4-7,9H,2-3,8H2,1H3,(H2,16,17,20)/b11-9- |
| InChIKey | GMKSNWJMQLXUHK-LUAWRHEFSA-N |
| XLogP | 2.42 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|