C21H30N6O — CID 154483881
1-[4-[[4-(dimethylamino)pyrimidin-2-yl]amino]cyclohexyl]-3-(1-phenylethyl)urea (PubChem CID 154483881) has the molecular formula C21H30N6O and a molecular weight of 382.51 g/mol. Its IUPAC name is 1-[4-[[4-(dimethylamino)pyrimidin-2-yl]amino]cyclohexyl]-3-(1-phenylethyl)urea.
| Compound Name | 1-[4-[[4-(dimethylamino)pyrimidin-2-yl]amino]cyclohexyl]-3-(1-phenylethyl)urea |
|---|---|
| PubChem CID | 154483881 |
| Molecular Formula | C21H30N6O |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 1-[4-[[4-(dimethylamino)pyrimidin-2-yl]amino]cyclohexyl]-3-(1-phenylethyl)urea |
| SMILES | CC(NC(=O)NC1CCC(Nc2nccc(N(C)C)n2)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H30N6O/c1-15(16-7-5-4-6-8-16)23-21(28)25-18-11-9-17(10-12-18)24-20-22-14-13-19(26-20)27(2)3/h4-8,13-15,17-18H,9-12H2,1-3H3,(H,22,24,26)(H2,23,25,28) |
| InChIKey | MXZJCOYPIHECSI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |