C25H30N6S — CID 23027375
1-[4-[[4-(dimethylamino)pyrimidin-2-yl]amino]cyclohexyl]-3-(2-phenylphenyl)thiourea (PubChem CID 23027375) has the molecular formula C25H30N6S and a molecular weight of 446.62 g/mol. Its IUPAC name is 1-[4-[[4-(dimethylamino)pyrimidin-2-yl]amino]cyclohexyl]-3-(2-phenylphenyl)thiourea.
| Compound Name | 1-[4-[[4-(dimethylamino)pyrimidin-2-yl]amino]cyclohexyl]-3-(2-phenylphenyl)thiourea |
|---|---|
| PubChem CID | 23027375 |
| Molecular Formula | C25H30N6S |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 1-[4-[[4-(dimethylamino)pyrimidin-2-yl]amino]cyclohexyl]-3-(2-phenylphenyl)thiourea |
| SMILES | CN(C)c1ccnc(NC2CCC(NC(=S)Nc3ccccc3-c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C25H30N6S/c1-31(2)23-16-17-26-24(30-23)27-19-12-14-20(15-13-19)28-25(32)29-22-11-7-6-10-21(22)18-8-4-3-5-9-18/h3-11,16-17,19-20H,12-15H2,1-2H3,(H,26,27,30)(H2,28,29,32) |
| InChIKey | AAALZCGGMAPJAD-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 65.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|