C21H30N6O2S — CID 23027635
1-(2,4-dimethoxyphenyl)-3-[4-[[4-(dimethylamino)pyrimidin-2-yl]amino]cyclohexyl]thiourea (PubChem CID 23027635) has the molecular formula C21H30N6O2S and a molecular weight of 430.58 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-[4-[[4-(dimethylamino)pyrimidin-2-yl]amino]cyclohexyl]thiourea.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-[4-[[4-(dimethylamino)pyrimidin-2-yl]amino]cyclohexyl]thiourea |
|---|---|
| PubChem CID | 23027635 |
| Molecular Formula | C21H30N6O2S |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-[4-[[4-(dimethylamino)pyrimidin-2-yl]amino]cyclohexyl]thiourea |
| SMILES | COc1ccc(NC(=S)NC2CCC(Nc3nccc(N(C)C)n3)CC2)c(OC)c1 |
| InChI | InChI=1S/C21H30N6O2S/c1-27(2)19-11-12-22-20(26-19)23-14-5-7-15(8-6-14)24-21(30)25-17-10-9-16(28-3)13-18(17)29-4/h9-15H,5-8H2,1-4H3,(H,22,23,26)(H2,24,25,30) |
| InChIKey | AOEAWLWGYLYLIZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 83.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|