C20H26BrN5O2 — CID 23027493
2-bromo-N-[4-[[4-(dimethylamino)pyrimidin-2-yl]amino]cyclohexyl]-5-methoxybenzamide (PubChem CID 23027493) has the molecular formula C20H26BrN5O2 and a molecular weight of 448.37 g/mol. Its IUPAC name is 2-bromo-N-[4-[[4-(dimethylamino)pyrimidin-2-yl]amino]cyclohexyl]-5-methoxybenzamide.
| Compound Name | 2-bromo-N-[4-[[4-(dimethylamino)pyrimidin-2-yl]amino]cyclohexyl]-5-methoxybenzamide |
|---|---|
| PubChem CID | 23027493 |
| Molecular Formula | C20H26BrN5O2 |
| Molecular Weight | 448.37 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 2-bromo-N-[4-[[4-(dimethylamino)pyrimidin-2-yl]amino]cyclohexyl]-5-methoxybenzamide |
| SMILES | COc1ccc(Br)c(C(=O)NC2CCC(Nc3nccc(N(C)C)n3)CC2)c1 |
| InChI | InChI=1S/C20H26BrN5O2/c1-26(2)18-10-11-22-20(25-18)24-14-6-4-13(5-7-14)23-19(27)16-12-15(28-3)8-9-17(16)21/h8-14H,4-7H2,1-3H3,(H,23,27)(H,22,24,25) |
| InChIKey | PIQKHPCSQLMRTA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |