C23H33N5O3 — CID 175245193
2-butyl-N-[4-[[4-(dimethylamino)pyrimidin-2-yl]amino]cyclohexyl]-3,4-dihydroxybenzamide (PubChem CID 175245193) has the molecular formula C23H33N5O3 and a molecular weight of 427.55 g/mol. Its IUPAC name is 2-butyl-N-[4-[[4-(dimethylamino)pyrimidin-2-yl]amino]cyclohexyl]-3,4-dihydroxybenzamide.
| Compound Name | 2-butyl-N-[4-[[4-(dimethylamino)pyrimidin-2-yl]amino]cyclohexyl]-3,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 175245193 |
| Molecular Formula | C23H33N5O3 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | 2-butyl-N-[4-[[4-(dimethylamino)pyrimidin-2-yl]amino]cyclohexyl]-3,4-dihydroxybenzamide |
| SMILES | CCCCc1c(C(=O)NC2CCC(Nc3nccc(N(C)C)n3)CC2)ccc(O)c1O |
| InChI | InChI=1S/C23H33N5O3/c1-4-5-6-17-18(11-12-19(29)21(17)30)22(31)25-15-7-9-16(10-8-15)26-23-24-14-13-20(27-23)28(2)3/h11-16,29-30H,4-10H2,1-3H3,(H,25,31)(H,24,26,27) |
| InChIKey | GZZIWLHBHMBFMX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 110.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|