C51H39Br3O3 — CID 15448864
(9R,18R,27R)-9,18,27-tris[(2-bromo-5-methoxyphenyl)methyl]heptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,21,23,25-dodecaene (PubChem CID 15448864) has the molecular formula C51H39Br3O3 and a molecular weight of 939.58 g/mol. Its IUPAC name is (9R,18R,27R)-9,18,27-tris[(2-bromo-5-methoxyphenyl)methyl]heptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,21,23,25-dodecaene.
| Compound Name | (9R,18R,27R)-9,18,27-tris[(2-bromo-5-methoxyphenyl)methyl]heptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,21,23,25-dodecaene |
|---|---|
| PubChem CID | 15448864 |
| Molecular Formula | C51H39Br3O3 |
| Molecular Weight | 939.58 g/mol |
| Exact Mass | 936.04 |
| IUPAC Name | (9R,18R,27R)-9,18,27-tris[(2-bromo-5-methoxyphenyl)methyl]heptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,21,23,25-dodecaene |
| SMILES | COc1ccc(Br)c(C[C@@H]2c3ccccc3-c3c2c2c(c4c3[C@H](Cc3cc(OC)ccc3Br)c3ccccc3-4)[C@H](Cc3cc(OC)ccc3Br)c3ccccc3-2)c1 |
| InChI | InChI=1S/C51H39Br3O3/c1-55-31-16-19-43(52)28(22-31)25-40-34-10-4-7-13-37(34)46-49(40)47-38-14-8-5-11-35(38)41(26-29-23-32(56-2)17-20-44(29)53)51(47)48-39-15-9-6-12-36(39)42(50(46)48)27-30-24-33(57-3)18-21-45(30)54/h4-24,40-42H,25-27H2,1-3H3/t40-,41-,42-/m1/s1 |
| InChIKey | AQNCLLOTKLANHM-ILGLXFKISA-N |
| XLogP | 14.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 939.58 |
| LogP ≤ 5 | 14.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |