C12H13N3O2S — CID 154490525
N-(benzylsulfamoyl)pyridin-2-amine (PubChem CID 154490525) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is N-(benzylsulfamoyl)pyridin-2-amine.
| Compound Name | N-(benzylsulfamoyl)pyridin-2-amine |
|---|---|
| PubChem CID | 154490525 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | N-(benzylsulfamoyl)pyridin-2-amine |
| SMILES | O=S(=O)(NCc1ccccc1)Nc1ccccn1 |
| InChI | InChI=1S/C12H13N3O2S/c16-18(17,15-12-8-4-5-9-13-12)14-10-11-6-2-1-3-7-11/h1-9,14H,10H2,(H,13,15) |
| InChIKey | TZUDLTHIHMEUKW-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |