C8H14N2O — CID 154502684
2-methoxy-4-methylcyclohexa-1,5-diene-1,4-diamine (PubChem CID 154502684) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is 2-methoxy-4-methylcyclohexa-1,5-diene-1,4-diamine.
| Compound Name | 2-methoxy-4-methylcyclohexa-1,5-diene-1,4-diamine |
|---|---|
| PubChem CID | 154502684 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 2-methoxy-4-methylcyclohexa-1,5-diene-1,4-diamine |
| SMILES | COC1=C(N)C=CC(C)(N)C1 |
| InChI | InChI=1S/C8H14N2O/c1-8(10)4-3-6(9)7(5-8)11-2/h3-4H,5,9-10H2,1-2H3 |
| InChIKey | RKTAGIDLOVRJOR-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |