C10H21NO — CID 143329605
ethane;(3Z)-4-methoxyhepta-1,3-dien-3-amine (PubChem CID 143329605) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is ethane;(3Z)-4-methoxyhepta-1,3-dien-3-amine.
| Compound Name | ethane;(3Z)-4-methoxyhepta-1,3-dien-3-amine |
|---|---|
| PubChem CID | 143329605 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | ethane;(3Z)-4-methoxyhepta-1,3-dien-3-amine |
| SMILES | C=C/C(N)=C(\CCC)OC.CC |
| InChI | InChI=1S/C8H15NO.C2H6/c1-4-6-8(10-3)7(9)5-2;1-2/h5H,2,4,6,9H2,1,3H3;1-2H3/b8-7-; |
| InChIKey | AYDFXNDOHMRGKV-CFYXSCKTSA-N |
| XLogP | 2.82 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|