C21H22FN4O5+ — CID 154505763
[N-(4-carboxy-3-fluorobenzenecarboximidoyl)-C-[4-(2-methylpiperidin-1-yl)-3-nitrophenyl]carbonimidoyl]oxidanium (PubChem CID 154505763) has the molecular formula C21H22FN4O5+ and a molecular weight of 429.43 g/mol. Its IUPAC name is [N-(4-carboxy-3-fluorobenzenecarboximidoyl)-C-[4-(2-methylpiperidin-1-yl)-3-nitrophenyl]carbonimidoyl]oxidanium.
| Compound Name | [N-(4-carboxy-3-fluorobenzenecarboximidoyl)-C-[4-(2-methylpiperidin-1-yl)-3-nitrophenyl]carbonimidoyl]oxidanium |
|---|---|
| PubChem CID | 154505763 |
| Molecular Formula | C21H22FN4O5+ |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | [N-(4-carboxy-3-fluorobenzenecarboximidoyl)-C-[4-(2-methylpiperidin-1-yl)-3-nitrophenyl]carbonimidoyl]oxidanium |
| SMILES | [H]/N=C(/N=C(\[OH2+])c1ccc(N2CCCCC2C)c([N+](=O)[O-])c1)c1ccc(C(=O)O)c(F)c1 |
| InChI | InChI=1S/C21H21FN4O5/c1-12-4-2-3-9-25(12)17-8-6-14(11-18(17)26(30)31)20(27)24-19(23)13-5-7-15(21(28)29)16(22)10-13/h5-8,10-12H,2-4,9H2,1H3,(H,28,29)(H2,23,24,27)/p+1 |
| InChIKey | FCGVFVYMSBLSKZ-UHFFFAOYSA-O |
| XLogP | 3.31 |
| TPSA | 142.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|