C15H21NO6 — CID 15450601
5-O-tert-butyl 3-O,7-O-dimethyl (1S,2S,3S,4S,6S,7S)-5-azatricyclo[4.1.0.02,4]heptane-3,5,7-tricarboxylate (PubChem CID 15450601) has the molecular formula C15H21NO6 and a molecular weight of 311.33 g/mol. Its IUPAC name is 5-O-tert-butyl 3-O,7-O-dimethyl (1S,2S,3S,4S,6S,7S)-5-azatricyclo[4.1.0.02,4]heptane-3,5,7-tricarboxylate.
| Compound Name | 5-O-tert-butyl 3-O,7-O-dimethyl (1S,2S,3S,4S,6S,7S)-5-azatricyclo[4.1.0.02,4]heptane-3,5,7-tricarboxylate |
|---|---|
| PubChem CID | 15450601 |
| Molecular Formula | C15H21NO6 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 5-O-tert-butyl 3-O,7-O-dimethyl (1S,2S,3S,4S,6S,7S)-5-azatricyclo[4.1.0.02,4]heptane-3,5,7-tricarboxylate |
| SMILES | COC(=O)[C@H]1[C@@H]2[C@H]3[C@H](C(=O)OC)[C@H]3N(C(=O)OC(C)(C)C)[C@H]12 |
| InChI | InChI=1S/C15H21NO6/c1-15(2,3)22-14(19)16-10-6(8(10)12(17)20-4)7-9(11(7)16)13(18)21-5/h6-11H,1-5H3/t6-,7-,8-,9-,10-,11-/m0/s1 |
| InChIKey | CDNIPEMRAJDNOA-PPQVSCAHSA-N |
| XLogP | 0.81 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|