C17H25NO6 — CID 135069872
5-O-tert-butyl 3-O,7-O-diethyl (1R,2R,3R,4R,6R)-5-azatricyclo[4.1.0.02,4]heptane-3,5,7-tricarboxylate (PubChem CID 135069872) has the molecular formula C17H25NO6 and a molecular weight of 339.39 g/mol. Its IUPAC name is 5-O-tert-butyl 3-O,7-O-diethyl (1R,2R,3R,4R,6R)-5-azatricyclo[4.1.0.02,4]heptane-3,5,7-tricarboxylate.
| Compound Name | 5-O-tert-butyl 3-O,7-O-diethyl (1R,2R,3R,4R,6R)-5-azatricyclo[4.1.0.02,4]heptane-3,5,7-tricarboxylate |
|---|---|
| PubChem CID | 135069872 |
| Molecular Formula | C17H25NO6 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 5-O-tert-butyl 3-O,7-O-diethyl (1R,2R,3R,4R,6R)-5-azatricyclo[4.1.0.02,4]heptane-3,5,7-tricarboxylate |
| SMILES | CCOC(=O)C1[C@H]2[C@@H]3[C@@H](C(=O)OCC)[C@@H]3N(C(=O)OC(C)(C)C)[C@@H]12 |
| InChI | InChI=1S/C17H25NO6/c1-6-22-14(19)10-8-9-11(15(20)23-7-2)13(9)18(12(8)10)16(21)24-17(3,4)5/h8-13H,6-7H2,1-5H3/t8-,9-,10-,11?,12-,13-/m1/s1 |
| InChIKey | OMRHUAYYZLMSLK-KZYBLIROSA-N |
| XLogP | 1.59 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|