C19H29NO6 — CID 71814225
5-O-tert-butyl 3-O,7-O-diethyl (1R,2R,3R,4R,6R,7R)-3,7-dimethyl-5-azatricyclo[4.1.0.02,4]heptane-3,5,7-tricarboxylate (PubChem CID 71814225) has the molecular formula C19H29NO6 and a molecular weight of 367.44 g/mol. Its IUPAC name is 5-O-tert-butyl 3-O,7-O-diethyl (1R,2R,3R,4R,6R,7R)-3,7-dimethyl-5-azatricyclo[4.1.0.02,4]heptane-3,5,7-tricarboxylate.
| Compound Name | 5-O-tert-butyl 3-O,7-O-diethyl (1R,2R,3R,4R,6R,7R)-3,7-dimethyl-5-azatricyclo[4.1.0.02,4]heptane-3,5,7-tricarboxylate |
|---|---|
| PubChem CID | 71814225 |
| Molecular Formula | C19H29NO6 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 5-O-tert-butyl 3-O,7-O-diethyl (1R,2R,3R,4R,6R,7R)-3,7-dimethyl-5-azatricyclo[4.1.0.02,4]heptane-3,5,7-tricarboxylate |
| SMILES | CCOC(=O)[C@]1(C)[C@H]2[C@H]3[C@@H](N(C(=O)OC(C)(C)C)[C@H]21)[C@]3(C)C(=O)OCC |
| InChI | InChI=1S/C19H29NO6/c1-8-24-14(21)18(6)10-11-13(19(11,7)15(22)25-9-2)20(12(10)18)16(23)26-17(3,4)5/h10-13H,8-9H2,1-7H3/t10-,11-,12+,13+,18+,19+/m0/s1 |
| InChIKey | KUKPDMLEZYOLOI-NSVSTSLTSA-N |
| XLogP | 2.37 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|