C26H20ClFN4O2S2 — CID 154506539
(6S)-3-(2-chlorophenyl)-6-[6-[(6-fluoro-5-methyl-3-pyridinyl)amino]-2-pyridinyl]-1-sulfanyl-6-thiophen-3-ylpiperidine-2,4-dione (PubChem CID 154506539) has the molecular formula C26H20ClFN4O2S2 and a molecular weight of 539.06 g/mol. Its IUPAC name is (6S)-3-(2-chlorophenyl)-6-[6-[(6-fluoro-5-methyl-3-pyridinyl)amino]-2-pyridinyl]-1-sulfanyl-6-thiophen-3-ylpiperidine-2,4-dione.
| Compound Name | (6S)-3-(2-chlorophenyl)-6-[6-[(6-fluoro-5-methyl-3-pyridinyl)amino]-2-pyridinyl]-1-sulfanyl-6-thiophen-3-ylpiperidine-2,4-dione |
|---|---|
| PubChem CID | 154506539 |
| Molecular Formula | C26H20ClFN4O2S2 |
| Molecular Weight | 539.06 g/mol |
| Exact Mass | 538.07 |
| IUPAC Name | (6S)-3-(2-chlorophenyl)-6-[6-[(6-fluoro-5-methyl-3-pyridinyl)amino]-2-pyridinyl]-1-sulfanyl-6-thiophen-3-ylpiperidine-2,4-dione |
| SMILES | Cc1cc(Nc2cccc([C@@]3(c4ccsc4)CC(=O)C(c4ccccc4Cl)C(=O)N3S)n2)cnc1F |
| InChI | InChI=1S/C26H20ClFN4O2S2/c1-15-11-17(13-29-24(15)28)30-22-8-4-7-21(31-22)26(16-9-10-36-14-16)12-20(33)23(25(34)32(26)35)18-5-2-3-6-19(18)27/h2-11,13-14,23,35H,12H2,1H3,(H,30,31)/t23?,26-/m0/s1 |
| InChIKey | UBMWCYYSUSOIGR-NASUQTAISA-N |
| XLogP | 6.06 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.06 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|