C8H11N3O3S — CID 154507017
[(6R)-4-amino-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl] carbamate (PubChem CID 154507017) has the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. Its IUPAC name is [(6R)-4-amino-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl] carbamate.
| Compound Name | [(6R)-4-amino-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl] carbamate |
|---|---|
| PubChem CID | 154507017 |
| Molecular Formula | C8H11N3O3S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | [(6R)-4-amino-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl] carbamate |
| SMILES | CC1(N)S[C@@H]2CC(=O)N2C=C1OC(N)=O |
| InChI | InChI=1S/C8H11N3O3S/c1-8(10)4(14-7(9)13)3-11-5(12)2-6(11)15-8/h3,6H,2,10H2,1H3,(H2,9,13)/t6-,8?/m1/s1 |
| InChIKey | QXFZQUUNJDPEBB-XPJFZRNWSA-N |
| XLogP | -0.10 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |