C10H14N2O2S2 — CID 155437357
S-[(Z)-prop-1-enyl] carbamothioate;(6R)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one (PubChem CID 155437357) has the molecular formula C10H14N2O2S2 and a molecular weight of 258.37 g/mol. Its IUPAC name is S-[(Z)-prop-1-enyl] carbamothioate;(6R)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one.
| Compound Name | S-[(Z)-prop-1-enyl] carbamothioate;(6R)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one |
|---|---|
| PubChem CID | 155437357 |
| Molecular Formula | C10H14N2O2S2 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | S-[(Z)-prop-1-enyl] carbamothioate;(6R)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one |
| SMILES | C/C=C\SC(N)=O.O=C1C[C@H]2SCC=CN12 |
| InChI | InChI=1S/C6H7NOS.C4H7NOS/c8-5-4-6-7(5)2-1-3-9-6;1-2-3-7-4(5)6/h1-2,6H,3-4H2;2-3H,1H3,(H2,5,6)/b;3-2-/t6-;/m1./s1 |
| InChIKey | CKPIWCNQCZXHPH-JBASPIHASA-N |
| XLogP | 2.14 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|