C19H12Cl2N2O7S — CID 154507392
N-(6,8-dichloro-4-hydroxy-2-oxochromen-3-yl)-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide (PubChem CID 154507392) has the molecular formula C19H12Cl2N2O7S and a molecular weight of 483.29 g/mol. Its IUPAC name is N-(6,8-dichloro-4-hydroxy-2-oxochromen-3-yl)-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide.
| Compound Name | N-(6,8-dichloro-4-hydroxy-2-oxochromen-3-yl)-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 154507392 |
| Molecular Formula | C19H12Cl2N2O7S |
| Molecular Weight | 483.29 g/mol |
| Exact Mass | 481.97 |
| IUPAC Name | N-(6,8-dichloro-4-hydroxy-2-oxochromen-3-yl)-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide |
| SMILES | CN1C(C(=O)Nc2c(O)c3cc(Cl)cc(Cl)c3oc2=O)=C(O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C19H12Cl2N2O7S/c1-23-14(16(25)9-4-2-3-5-12(9)31(23,28)29)18(26)22-13-15(24)10-6-8(20)7-11(21)17(10)30-19(13)27/h2-7,24-25H,1H3,(H,22,26) |
| InChIKey | DLGOPYORVZIFIZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 137.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|