C9H8F3O3P-2 — CID 154510628
dioxido-oxo-[2,2,2-trifluoro-1-(2-methylphenyl)ethyl]-λ5-phosphane (PubChem CID 154510628) has the molecular formula C9H8F3O3P-2 and a molecular weight of 252.13 g/mol. Its IUPAC name is dioxido-oxo-[2,2,2-trifluoro-1-(2-methylphenyl)ethyl]-λ5-phosphane.
| Compound Name | dioxido-oxo-[2,2,2-trifluoro-1-(2-methylphenyl)ethyl]-λ5-phosphane |
|---|---|
| PubChem CID | 154510628 |
| Molecular Formula | C9H8F3O3P-2 |
| Molecular Weight | 252.13 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | dioxido-oxo-[2,2,2-trifluoro-1-(2-methylphenyl)ethyl]-λ5-phosphane |
| SMILES | Cc1ccccc1C(C(F)(F)F)P(=O)([O-])[O-] |
| InChI | InChI=1S/C9H10F3O3P/c1-6-4-2-3-5-7(6)8(9(10,11)12)16(13,14)15/h2-5,8H,1H3,(H2,13,14,15)/p-2 |
| InChIKey | HBOHXAKGKNDWJS-UHFFFAOYSA-L |
| XLogP | 1.51 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.13 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|