[1-(2-ethylphenyl)-2,2,2-trifluoroethyl]phosphonic acid

C10H12F3O3P — CID 66796809

IUPAC[1-(2-ethylphenyl)-2,2,2-trifluoroethyl]phosphonic acid
SMILESCCc1ccccc1C(C(F)(F)F)P(=O)(O)O
InChIInChI=1S/C10H12F3O3P/c1-2-7-5-3-4-6-8(7)9(10(11,12)13)17(14,15)16/h3-6,9H,2H2,1H3,(H2,14,15,16)
InChIKeyYUQYLJKJNGOLJU-UHFFFAOYSA-N
MW268.17 g/mol
LogP3.03
Rot. Bonds3

About [1-(2-ethylphenyl)-2,2,2-trifluoroethyl]phosphonic acid

[1-(2-ethylphenyl)-2,2,2-trifluoroethyl]phosphonic acid (PubChem CID 66796809) has the molecular formula C10H12F3O3P and a molecular weight of 268.17 g/mol. Its IUPAC name is [1-(2-ethylphenyl)-2,2,2-trifluoroethyl]phosphonic acid.

Molecular Properties

Compound Name[1-(2-ethylphenyl)-2,2,2-trifluoroethyl]phosphonic acid
PubChem CID66796809
Molecular FormulaC10H12F3O3P
Molecular Weight268.17 g/mol
Exact Mass268.05
IUPAC Name[1-(2-ethylphenyl)-2,2,2-trifluoroethyl]phosphonic acid
SMILESCCc1ccccc1C(C(F)(F)F)P(=O)(O)O
InChIInChI=1S/C10H12F3O3P/c1-2-7-5-3-4-6-8(7)9(10(11,12)13)17(14,15)16/h3-6,9H,2H2,1H3,(H2,14,15,16)
InChIKeyYUQYLJKJNGOLJU-UHFFFAOYSA-N
XLogP3.03
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.17
LogP ≤ 53.03
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze [1-(2-ethylphenyl)-2,2,2-trifluoroethyl]phosphonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [1-(2-ethylphenyl)-2,2,2-trifluoroethyl]phosphonic acid?
The IUPAC name of [1-(2-ethylphenyl)-2,2,2-trifluoroethyl]phosphonic acid (CID 66796809) is [1-(2-ethylphenyl)-2,2,2-trifluoroethyl]phosphonic acid.
What is the SMILES notation for [1-(2-ethylphenyl)-2,2,2-trifluoroethyl]phosphonic acid?
The canonical SMILES for [1-(2-ethylphenyl)-2,2,2-trifluoroethyl]phosphonic acid is CCc1ccccc1C(C(F)(F)F)P(=O)(O)O.
What is the InChIKey of [1-(2-ethylphenyl)-2,2,2-trifluoroethyl]phosphonic acid?
The InChIKey is YUQYLJKJNGOLJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F3O3P/c1-2-7-5-3-4-6-8(7)9(10(11,12)13)17(14,15)16/h3-6,9H,2H2,1H3,(H2,14,15,16).
What are the key properties of [1-(2-ethylphenyl)-2,2,2-trifluoroethyl]phosphonic acid?
[1-(2-ethylphenyl)-2,2,2-trifluoroethyl]phosphonic acid has a molecular weight of 268.17 g/mol, XLogP of 3.03, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2-ethylphenyl)-2,2,2-trifluoroethyl]phosphonic acid is sourced from PubChem (CID 66796809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).