C10H12F3O3P — CID 66796809
[1-(2-ethylphenyl)-2,2,2-trifluoroethyl]phosphonic acid (PubChem CID 66796809) has the molecular formula C10H12F3O3P and a molecular weight of 268.17 g/mol. Its IUPAC name is [1-(2-ethylphenyl)-2,2,2-trifluoroethyl]phosphonic acid.
| Compound Name | [1-(2-ethylphenyl)-2,2,2-trifluoroethyl]phosphonic acid |
|---|---|
| PubChem CID | 66796809 |
| Molecular Formula | C10H12F3O3P |
| Molecular Weight | 268.17 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | [1-(2-ethylphenyl)-2,2,2-trifluoroethyl]phosphonic acid |
| SMILES | CCc1ccccc1C(C(F)(F)F)P(=O)(O)O |
| InChI | InChI=1S/C10H12F3O3P/c1-2-7-5-3-4-6-8(7)9(10(11,12)13)17(14,15)16/h3-6,9H,2H2,1H3,(H2,14,15,16) |
| InChIKey | YUQYLJKJNGOLJU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.17 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|