C10H6F5NO4 — CID 154510965
(1,1,2,2,2-pentafluoroethoxycarbonylamino) benzoate (PubChem CID 154510965) has the molecular formula C10H6F5NO4 and a molecular weight of 299.15 g/mol. Its IUPAC name is (1,1,2,2,2-pentafluoroethoxycarbonylamino) benzoate.
| Compound Name | (1,1,2,2,2-pentafluoroethoxycarbonylamino) benzoate |
|---|---|
| PubChem CID | 154510965 |
| Molecular Formula | C10H6F5NO4 |
| Molecular Weight | 299.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | (1,1,2,2,2-pentafluoroethoxycarbonylamino) benzoate |
| SMILES | O=C(NOC(=O)c1ccccc1)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H6F5NO4/c11-9(12,13)10(14,15)19-8(18)16-20-7(17)6-4-2-1-3-5-6/h1-5H,(H,16,18) |
| InChIKey | WMKLRFPDGLHHOD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.15 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|