C12H26O2S4 — CID 154512556
2-[3-[2-(3-ethylsulfanylpropylsulfanyl)ethylsulfanyl]propylsulfanyl]ethane-1,1-diol (PubChem CID 154512556) has the molecular formula C12H26O2S4 and a molecular weight of 330.61 g/mol. Its IUPAC name is 2-[3-[2-(3-ethylsulfanylpropylsulfanyl)ethylsulfanyl]propylsulfanyl]ethane-1,1-diol.
| Compound Name | 2-[3-[2-(3-ethylsulfanylpropylsulfanyl)ethylsulfanyl]propylsulfanyl]ethane-1,1-diol |
|---|---|
| PubChem CID | 154512556 |
| Molecular Formula | C12H26O2S4 |
| Molecular Weight | 330.61 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 2-[3-[2-(3-ethylsulfanylpropylsulfanyl)ethylsulfanyl]propylsulfanyl]ethane-1,1-diol |
| SMILES | CCSCCCSCCSCCCSCC(O)O |
| InChI | InChI=1S/C12H26O2S4/c1-2-15-5-3-6-16-9-10-17-7-4-8-18-11-12(13)14/h12-14H,2-11H2,1H3 |
| InChIKey | QNAYMWSKPOUPJF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.61 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|