C6H12Br2S2 — CID 56988774
1,1-dibromo-2-(2-ethylsulfanylethylsulfanyl)ethane (PubChem CID 56988774) has the molecular formula C6H12Br2S2 and a molecular weight of 308.10 g/mol. Its IUPAC name is 1,1-dibromo-2-(2-ethylsulfanylethylsulfanyl)ethane.
| Compound Name | 1,1-dibromo-2-(2-ethylsulfanylethylsulfanyl)ethane |
|---|---|
| PubChem CID | 56988774 |
| Molecular Formula | C6H12Br2S2 |
| Molecular Weight | 308.10 g/mol |
| Exact Mass | 305.87 |
| IUPAC Name | 1,1-dibromo-2-(2-ethylsulfanylethylsulfanyl)ethane |
| SMILES | CCSCCSCC(Br)Br |
| InChI | InChI=1S/C6H12Br2S2/c1-2-9-3-4-10-5-6(7)8/h6H,2-5H2,1H3 |
| InChIKey | NHQLIYRHKRUHCI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.10 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|