C20H28O4 — CID 154513908
8-[2-(4-hydroxy-6-oxooxan-2-yl)ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalene-1-carbaldehyde (PubChem CID 154513908) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is 8-[2-(4-hydroxy-6-oxooxan-2-yl)ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalene-1-carbaldehyde.
| Compound Name | 8-[2-(4-hydroxy-6-oxooxan-2-yl)ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 154513908 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 8-[2-(4-hydroxy-6-oxooxan-2-yl)ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalene-1-carbaldehyde |
| SMILES | CC1C=C2C=CC(C)C(CCC3CC(O)CC(=O)O3)C2C(C=O)C1 |
| InChI | InChI=1S/C20H28O4/c1-12-7-14-4-3-13(2)18(20(14)15(8-12)11-21)6-5-17-9-16(22)10-19(23)24-17/h3-4,7,11-13,15-18,20,22H,5-6,8-10H2,1-2H3 |
| InChIKey | IGBCODMAZAGNFR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|