C11H12IN3O — CID 154514161
2-cyclopropyl-5-iodo-8-methoxy-7-methyl-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 154514161) has the molecular formula C11H12IN3O and a molecular weight of 329.14 g/mol. Its IUPAC name is 2-cyclopropyl-5-iodo-8-methoxy-7-methyl-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-cyclopropyl-5-iodo-8-methoxy-7-methyl-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 154514161 |
| Molecular Formula | C11H12IN3O |
| Molecular Weight | 329.14 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | 2-cyclopropyl-5-iodo-8-methoxy-7-methyl-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | COc1c(C)cc(I)n2nc(C3CC3)nc12 |
| InChI | InChI=1S/C11H12IN3O/c1-6-5-8(12)15-11(9(6)16-2)13-10(14-15)7-3-4-7/h5,7H,3-4H2,1-2H3 |
| InChIKey | RIWOMLQSSQHPFC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.14 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|