C10H10BN3O — CID 88576732
CID 88576732 (PubChem CID 88576732) has the molecular formula C10H10BN3O and a molecular weight of 199.02 g/mol.
| Compound Name | CID 88576732 |
|---|---|
| PubChem CID | 88576732 |
| Molecular Formula | C10H10BN3O |
| Molecular Weight | 199.02 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(OC)c2nc(C3CC3)nn12 |
| InChI | InChI=1S/C10H10BN3O/c1-15-7-4-5-8(11)14-10(7)12-9(13-14)6-2-3-6/h4-6H,2-3H2,1H3 |
| InChIKey | MQAWSPIWVJRBBV-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.02 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|