C10H12BN3O3 — CID 58074662
(2-cyclopropyl-8-methoxy-[1,2,4]triazolo[1,5-a]pyridin-5-yl)boronic acid (PubChem CID 58074662) has the molecular formula C10H12BN3O3 and a molecular weight of 233.04 g/mol. Its IUPAC name is (2-cyclopropyl-8-methoxy-[1,2,4]triazolo[1,5-a]pyridin-5-yl)boronic acid.
| Compound Name | (2-cyclopropyl-8-methoxy-[1,2,4]triazolo[1,5-a]pyridin-5-yl)boronic acid |
|---|---|
| PubChem CID | 58074662 |
| Molecular Formula | C10H12BN3O3 |
| Molecular Weight | 233.04 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | (2-cyclopropyl-8-methoxy-[1,2,4]triazolo[1,5-a]pyridin-5-yl)boronic acid |
| SMILES | COc1ccc(B(O)O)n2nc(C3CC3)nc12 |
| InChI | InChI=1S/C10H12BN3O3/c1-17-7-4-5-8(11(15)16)14-10(7)12-9(13-14)6-2-3-6/h4-6,15-16H,2-3H2,1H3 |
| InChIKey | ZHFCJWBHHGGVQG-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 79.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.04 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|