C7H13N3O2 — CID 154516606
N-(1-methyl-2-oxo-1,3-diazinan-4-yl)acetamide (PubChem CID 154516606) has the molecular formula C7H13N3O2 and a molecular weight of 171.20 g/mol. Its IUPAC name is N-(1-methyl-2-oxo-1,3-diazinan-4-yl)acetamide.
| Compound Name | N-(1-methyl-2-oxo-1,3-diazinan-4-yl)acetamide |
|---|---|
| PubChem CID | 154516606 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | N-(1-methyl-2-oxo-1,3-diazinan-4-yl)acetamide |
| SMILES | CC(=O)NC1CCN(C)C(=O)N1 |
| InChI | InChI=1S/C7H13N3O2/c1-5(11)8-6-3-4-10(2)7(12)9-6/h6H,3-4H2,1-2H3,(H,8,11)(H,9,12) |
| InChIKey | HZCCFIZFXSBNSG-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |