C8H14N2S — CID 154517615
2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-2-ylmethanethiol (PubChem CID 154517615) has the molecular formula C8H14N2S and a molecular weight of 170.28 g/mol. Its IUPAC name is 2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-2-ylmethanethiol.
| Compound Name | 2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-2-ylmethanethiol |
|---|---|
| PubChem CID | 154517615 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-2-ylmethanethiol |
| SMILES | SCC1CCN2CCCC2=N1 |
| InChI | InChI=1S/C8H14N2S/c11-6-7-3-5-10-4-1-2-8(10)9-7/h7,11H,1-6H2 |
| InChIKey | AJLLROSBYKFYQU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 15.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|