C6H10N2S — CID 175747989
3,6,7,8-tetrahydro-2H-pyrrolo[1,2-b][1,2,4]thiadiazine (PubChem CID 175747989) has the molecular formula C6H10N2S and a molecular weight of 142.23 g/mol. Its IUPAC name is 3,6,7,8-tetrahydro-2H-pyrrolo[1,2-b][1,2,4]thiadiazine.
| Compound Name | 3,6,7,8-tetrahydro-2H-pyrrolo[1,2-b][1,2,4]thiadiazine |
|---|---|
| PubChem CID | 175747989 |
| Molecular Formula | C6H10N2S |
| Molecular Weight | 142.23 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 3,6,7,8-tetrahydro-2H-pyrrolo[1,2-b][1,2,4]thiadiazine |
| SMILES | C1CC2=NCCSN2C1 |
| InChI | InChI=1S/C6H10N2S/c1-2-6-7-3-5-9-8(6)4-1/h1-5H2 |
| InChIKey | ZYGWBDCIRPQJDX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.23 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|