C7H11N3S — CID 163827313
4-methyl-4,6,7,8-tetrahydropyrrolo[1,2-a][1,3,5]triazine-7-thiol (PubChem CID 163827313) has the molecular formula C7H11N3S and a molecular weight of 169.25 g/mol. Its IUPAC name is 4-methyl-4,6,7,8-tetrahydropyrrolo[1,2-a][1,3,5]triazine-7-thiol.
| Compound Name | 4-methyl-4,6,7,8-tetrahydropyrrolo[1,2-a][1,3,5]triazine-7-thiol |
|---|---|
| PubChem CID | 163827313 |
| Molecular Formula | C7H11N3S |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 4-methyl-4,6,7,8-tetrahydropyrrolo[1,2-a][1,3,5]triazine-7-thiol |
| SMILES | CC1N=CN=C2CC(S)CN21 |
| InChI | InChI=1S/C7H11N3S/c1-5-8-4-9-7-2-6(11)3-10(5)7/h4-6,11H,2-3H2,1H3 |
| InChIKey | OAPOUTSQTORTIL-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 27.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|