C7H12N2S — CID 154515773
2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidine-3-thiol (PubChem CID 154515773) has the molecular formula C7H12N2S and a molecular weight of 156.25 g/mol. Its IUPAC name is 2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidine-3-thiol.
| Compound Name | 2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidine-3-thiol |
|---|---|
| PubChem CID | 154515773 |
| Molecular Formula | C7H12N2S |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidine-3-thiol |
| SMILES | SC1CN=C2CCCN2C1 |
| InChI | InChI=1S/C7H12N2S/c10-6-4-8-7-2-1-3-9(7)5-6/h6,10H,1-5H2 |
| InChIKey | KEAMHRQGSYPJPT-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 15.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|