C23H38O5 — CID 154520914
4-[(5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3,4,4-trihydroxybutanoic acid (PubChem CID 154520914) has the molecular formula C23H38O5 and a molecular weight of 394.55 g/mol. Its IUPAC name is 4-[(5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3,4,4-trihydroxybutanoic acid.
| Compound Name | 4-[(5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3,4,4-trihydroxybutanoic acid |
|---|---|
| PubChem CID | 154520914 |
| Molecular Formula | C23H38O5 |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 4-[(5S,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3,4,4-trihydroxybutanoic acid |
| SMILES | C[C@]12CCCC[C@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](C(O)(O)C(O)CC(=O)O)CC[C@@H]12 |
| InChI | InChI=1S/C23H38O5/c1-21-11-4-3-5-14(21)6-7-15-16-8-9-18(22(16,2)12-10-17(15)21)23(27,28)19(24)13-20(25)26/h14-19,24,27-28H,3-13H2,1-2H3,(H,25,26)/t14-,15-,16-,17-,18-,19?,21-,22-/m0/s1 |
| InChIKey | BSIMUDXNZQMZQN-ODIXAFDOSA-N |
| XLogP | 3.55 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|