C15H11NO2 — CID 154523393
2,3-dimethylbenzo[g]quinoline-5,10-dione (PubChem CID 154523393) has the molecular formula C15H11NO2 and a molecular weight of 237.26 g/mol. Its IUPAC name is 2,3-dimethylbenzo[g]quinoline-5,10-dione.
| Compound Name | 2,3-dimethylbenzo[g]quinoline-5,10-dione |
|---|---|
| PubChem CID | 154523393 |
| Molecular Formula | C15H11NO2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 2,3-dimethylbenzo[g]quinoline-5,10-dione |
| SMILES | Cc1cc2c(nc1C)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C15H11NO2/c1-8-7-12-13(16-9(8)2)15(18)11-6-4-3-5-10(11)14(12)17/h3-7H,1-2H3 |
| InChIKey | CHGNMMLESKANAT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|